C14H9ClN2OS — CID 1080677
3-chloro-N-pyridin-4-yl-1-benzothiophene-2-carboxamide (PubChem CID 1080677) has the molecular formula C14H9ClN2OS and a molecular weight of 288.76 g/mol. Its IUPAC name is 3-chloro-N-pyridin-4-yl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-pyridin-4-yl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 1080677 |
| Molecular Formula | C14H9ClN2OS |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 3-chloro-N-pyridin-4-yl-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C14H9ClN2OS/c15-12-10-3-1-2-4-11(10)19-13(12)14(18)17-9-5-7-16-8-6-9/h1-8H,(H,16,17,18) |
| InChIKey | VRCFEDBVJWWFKZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |