C20H14ClN3O2S2 — CID 71664582
4-[5-[(2-chloro-4-pyridinyl)methylcarbamoyl]thiophen-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 71664582) has the molecular formula C20H14ClN3O2S2 and a molecular weight of 427.94 g/mol. Its IUPAC name is 4-[5-[(2-chloro-4-pyridinyl)methylcarbamoyl]thiophen-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 4-[5-[(2-chloro-4-pyridinyl)methylcarbamoyl]thiophen-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 71664582 |
| Molecular Formula | C20H14ClN3O2S2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 4-[5-[(2-chloro-4-pyridinyl)methylcarbamoyl]thiophen-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | NC(=O)c1cc2c(-c3ccc(C(=O)NCc4ccnc(Cl)c4)s3)cccc2s1 |
| InChI | InChI=1S/C20H14ClN3O2S2/c21-18-8-11(6-7-23-18)10-24-20(26)16-5-4-15(27-16)12-2-1-3-14-13(12)9-17(28-14)19(22)25/h1-9H,10H2,(H2,22,25)(H,24,26) |
| InChIKey | SKAFXNGFXPGQIG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|