C17H16N4O2S — CID 11645815
5-(6-aminopyrimidin-4-yl)-N-[(3-methoxyphenyl)methyl]thiophene-2-carboxamide (PubChem CID 11645815) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 5-(6-aminopyrimidin-4-yl)-N-[(3-methoxyphenyl)methyl]thiophene-2-carboxamide.
| Compound Name | 5-(6-aminopyrimidin-4-yl)-N-[(3-methoxyphenyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11645815 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 5-(6-aminopyrimidin-4-yl)-N-[(3-methoxyphenyl)methyl]thiophene-2-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2ccc(-c3cc(N)ncn3)s2)c1 |
| InChI | InChI=1S/C17H16N4O2S/c1-23-12-4-2-3-11(7-12)9-19-17(22)15-6-5-14(24-15)13-8-16(18)21-10-20-13/h2-8,10H,9H2,1H3,(H,19,22)(H2,18,20,21) |
| InChIKey | COKRNWBCLKOZME-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |