C17H18Cl2FNO — CID 10807218
N,N-bis(2-chloroethyl)-2-fluoro-4-phenylmethoxyaniline (PubChem CID 10807218) has the molecular formula C17H18Cl2FNO and a molecular weight of 342.24 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-2-fluoro-4-phenylmethoxyaniline.
| Compound Name | N,N-bis(2-chloroethyl)-2-fluoro-4-phenylmethoxyaniline |
|---|---|
| PubChem CID | 10807218 |
| Molecular Formula | C17H18Cl2FNO |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N,N-bis(2-chloroethyl)-2-fluoro-4-phenylmethoxyaniline |
| SMILES | Fc1cc(OCc2ccccc2)ccc1N(CCCl)CCCl |
| InChI | InChI=1S/C17H18Cl2FNO/c18-8-10-21(11-9-19)17-7-6-15(12-16(17)20)22-13-14-4-2-1-3-5-14/h1-7,12H,8-11,13H2 |
| InChIKey | VCLZBAYIVKOFEZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|