C12H10F10 — CID 10807360
cis-(1S,3R)-1,3-bis[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclohexane (PubChem CID 10807360) has the molecular formula C12H10F10 and a molecular weight of 344.19 g/mol. Its IUPAC name is cis-(1S,3R)-1,3-bis[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclohexane.
| Compound Name | cis-(1S,3R)-1,3-bis[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 10807360 |
| Molecular Formula | C12H10F10 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | cis-(1S,3R)-1,3-bis[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclohexane |
| SMILES | F/C(=C(\F)C(F)(F)F)[C@@H]1CCC[C@H](/C(F)=C(/F)C(F)(F)F)C1 |
| InChI | InChI=1S/C12H10F10/c13-7(9(15)11(17,18)19)5-2-1-3-6(4-5)8(14)10(16)12(20,21)22/h5-6H,1-4H2/b9-7-,10-8-/t5-,6+ |
| InChIKey | MJBXHOZRVNWMAY-NFDCECIOSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |