C16H34O4Si2 — CID 10807574
dipropan-2-yl (2S,3S)-2,3-bis(trimethylsilyl)butanedioate (PubChem CID 10807574) has the molecular formula C16H34O4Si2 and a molecular weight of 346.62 g/mol. Its IUPAC name is dipropan-2-yl (2S,3S)-2,3-bis(trimethylsilyl)butanedioate.
| Compound Name | dipropan-2-yl (2S,3S)-2,3-bis(trimethylsilyl)butanedioate |
|---|---|
| PubChem CID | 10807574 |
| Molecular Formula | C16H34O4Si2 |
| Molecular Weight | 346.62 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | dipropan-2-yl (2S,3S)-2,3-bis(trimethylsilyl)butanedioate |
| SMILES | CC(C)OC(=O)[C@@H]([C@H](C(=O)OC(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H34O4Si2/c1-11(2)19-15(17)13(21(5,6)7)14(22(8,9)10)16(18)20-12(3)4/h11-14H,1-10H3/t13-,14-/m1/s1 |
| InChIKey | NYNAOIUWKKFSPO-ZIAGYGMSSA-N |
| XLogP | 4.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|