C20H17NO5 — CID 10807835
(E)-3-[1-(carboxymethyl)-6-phenylmethoxyindol-3-yl]prop-2-enoic acid (PubChem CID 10807835) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is (E)-3-[1-(carboxymethyl)-6-phenylmethoxyindol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-(carboxymethyl)-6-phenylmethoxyindol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10807835 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (E)-3-[1-(carboxymethyl)-6-phenylmethoxyindol-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cn(CC(=O)O)c2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C20H17NO5/c22-19(23)9-6-15-11-21(12-20(24)25)18-10-16(7-8-17(15)18)26-13-14-4-2-1-3-5-14/h1-11H,12-13H2,(H,22,23)(H,24,25)/b9-6+ |
| InChIKey | ODGZKNZZKUYDRD-RMKNXTFCSA-N |
| XLogP | 3.40 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|