C20H17NO4 — CID 142024649
(E)-3-[3-(2-oxoethyl)-5-phenylmethoxyindol-1-yl]prop-2-enoic acid (PubChem CID 142024649) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is (E)-3-[3-(2-oxoethyl)-5-phenylmethoxyindol-1-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(2-oxoethyl)-5-phenylmethoxyindol-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 142024649 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (E)-3-[3-(2-oxoethyl)-5-phenylmethoxyindol-1-yl]prop-2-enoic acid |
| SMILES | O=CCc1cn(/C=C/C(=O)O)c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C20H17NO4/c22-11-9-16-13-21(10-8-20(23)24)19-7-6-17(12-18(16)19)25-14-15-4-2-1-3-5-15/h1-8,10-13H,9,14H2,(H,23,24)/b10-8+ |
| InChIKey | JXQKWWUBSKLPCC-CSKARUKUSA-N |
| XLogP | 3.52 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|