C12H20INO3 — CID 10807963
tert-butyl (4R)-4-[(E)-2-iodoethenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10807963) has the molecular formula C12H20INO3 and a molecular weight of 353.20 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(E)-2-iodoethenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(E)-2-iodoethenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10807963 |
| Molecular Formula | C12H20INO3 |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | tert-butyl (4R)-4-[(E)-2-iodoethenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](/C=C/I)COC1(C)C |
| InChI | InChI=1S/C12H20INO3/c1-11(2,3)17-10(15)14-9(6-7-13)8-16-12(14,4)5/h6-7,9H,8H2,1-5H3/b7-6+/t9-/m1/s1 |
| InChIKey | QVNCTWCURZHEDS-XCODYQFDSA-N |
| XLogP | 3.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|