C15H29NO3Si — CID 11141095
tert-butyl (4R)-2,2-dimethyl-4-[(E)-2-trimethylsilylethenyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 11141095) has the molecular formula C15H29NO3Si and a molecular weight of 299.49 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[(E)-2-trimethylsilylethenyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[(E)-2-trimethylsilylethenyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11141095 |
| Molecular Formula | C15H29NO3Si |
| Molecular Weight | 299.49 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[(E)-2-trimethylsilylethenyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](/C=C/[Si](C)(C)C)COC1(C)C |
| InChI | InChI=1S/C15H29NO3Si/c1-14(2,3)19-13(17)16-12(9-10-20(6,7)8)11-18-15(16,4)5/h9-10,12H,11H2,1-8H3/b10-9+/t12-/m1/s1 |
| InChIKey | FXOGWHAYHBHJQT-BZYZDCJZSA-N |
| XLogP | 3.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|