C11H19NO3 — CID 91345344
tert-butyl 2-prop-2-enyl-1,3-oxazolidine-3-carboxylate (PubChem CID 91345344) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is tert-butyl 2-prop-2-enyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 2-prop-2-enyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 91345344 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | tert-butyl 2-prop-2-enyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCC1OCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19NO3/c1-5-6-9-12(7-8-14-9)10(13)15-11(2,3)4/h5,9H,1,6-8H2,2-4H3 |
| InChIKey | NENLUHPOLHURIV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|