C17H31NO3Si — CID 10616070
tert-butyl (4S)-2,2-dimethyl-4-(3-trimethylsilylbuta-1,2-dienyl)-1,3-oxazolidine-3-carboxylate (PubChem CID 10616070) has the molecular formula C17H31NO3Si and a molecular weight of 325.53 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-(3-trimethylsilylbuta-1,2-dienyl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-(3-trimethylsilylbuta-1,2-dienyl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10616070 |
| Molecular Formula | C17H31NO3Si |
| Molecular Weight | 325.53 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-(3-trimethylsilylbuta-1,2-dienyl)-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(=C=C[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H31NO3Si/c1-13(22(7,8)9)10-11-14-12-20-17(5,6)18(14)15(19)21-16(2,3)4/h11,14H,12H2,1-9H3/t10?,14-/m0/s1 |
| InChIKey | BRONNBHMMUGASG-SBNLOKMTSA-N |
| XLogP | 4.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|