C16H31NO3Si — CID 102184012
tert-butyl (4R)-2,2-dimethyl-4-[(Z)-3-trimethylsilylprop-1-enyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 102184012) has the molecular formula C16H31NO3Si and a molecular weight of 313.51 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[(Z)-3-trimethylsilylprop-1-enyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[(Z)-3-trimethylsilylprop-1-enyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102184012 |
| Molecular Formula | C16H31NO3Si |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[(Z)-3-trimethylsilylprop-1-enyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](/C=C\C[Si](C)(C)C)COC1(C)C |
| InChI | InChI=1S/C16H31NO3Si/c1-15(2,3)20-14(18)17-13(12-19-16(17,4)5)10-9-11-21(6,7)8/h9-10,13H,11-12H2,1-8H3/b10-9-/t13-/m1/s1 |
| InChIKey | GHLJPUVEULLCGT-ASCRHOAZSA-N |
| XLogP | 4.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|