C20H37NO3Si — CID 10714029
tert-butyl (4S)-2,2-dimethyl-4-(3-trimethylsilylhepta-1,2-dienyl)-1,3-oxazolidine-3-carboxylate (PubChem CID 10714029) has the molecular formula C20H37NO3Si and a molecular weight of 367.61 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-(3-trimethylsilylhepta-1,2-dienyl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-(3-trimethylsilylhepta-1,2-dienyl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10714029 |
| Molecular Formula | C20H37NO3Si |
| Molecular Weight | 367.61 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-(3-trimethylsilylhepta-1,2-dienyl)-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCC(=C=C[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H37NO3Si/c1-10-11-12-17(25(7,8)9)14-13-16-15-23-20(5,6)21(16)18(22)24-19(2,3)4/h13,16H,10-12,15H2,1-9H3/t14?,16-/m0/s1 |
| InChIKey | LYJWQBRRDVZFIN-WMCAAGNKSA-N |
| XLogP | 5.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|