C19H25NO6 — CID 10808698
[(1S,2R,6S,10R,12R)-10-butoxy-5,7,9-trioxa-8-azatricyclo[6.4.0.02,6]dodecan-12-yl] benzoate (PubChem CID 10808698) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is [(1S,2R,6S,10R,12R)-10-butoxy-5,7,9-trioxa-8-azatricyclo[6.4.0.02,6]dodecan-12-yl] benzoate.
| Compound Name | [(1S,2R,6S,10R,12R)-10-butoxy-5,7,9-trioxa-8-azatricyclo[6.4.0.02,6]dodecan-12-yl] benzoate |
|---|---|
| PubChem CID | 10808698 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | [(1S,2R,6S,10R,12R)-10-butoxy-5,7,9-trioxa-8-azatricyclo[6.4.0.02,6]dodecan-12-yl] benzoate |
| SMILES | CCCCO[C@H]1C[C@@H](OC(=O)c2ccccc2)[C@@H]2[C@H]3CCO[C@H]3ON2O1 |
| InChI | InChI=1S/C19H25NO6/c1-2-3-10-22-16-12-15(24-18(21)13-7-5-4-6-8-13)17-14-9-11-23-19(14)26-20(17)25-16/h4-8,14-17,19H,2-3,9-12H2,1H3/t14-,15-,16-,17+,19+/m1/s1 |
| InChIKey | OUSGKJOVFPQVKJ-RXYDEIHYSA-N |
| XLogP | 2.67 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|