C24H35NO6 — CID 155930845
[(2S)-2-[(2S,3aR,5R,7R)-2-ethoxy-5-methyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-7-yl]-3-(2-methyl-1,3-dioxolan-2-yl)propyl] benzoate (PubChem CID 155930845) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is [(2S)-2-[(2S,3aR,5R,7R)-2-ethoxy-5-methyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-7-yl]-3-(2-methyl-1,3-dioxolan-2-yl)propyl] benzoate.
| Compound Name | [(2S)-2-[(2S,3aR,5R,7R)-2-ethoxy-5-methyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-7-yl]-3-(2-methyl-1,3-dioxolan-2-yl)propyl] benzoate |
|---|---|
| PubChem CID | 155930845 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | [(2S)-2-[(2S,3aR,5R,7R)-2-ethoxy-5-methyl-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-7-yl]-3-(2-methyl-1,3-dioxolan-2-yl)propyl] benzoate |
| SMILES | CCO[C@@H]1C[C@H]2C[C@@H](C)C[C@H]([C@@H](COC(=O)c3ccccc3)CC3(C)OCCO3)N2O1 |
| InChI | InChI=1S/C24H35NO6/c1-4-27-22-14-20-12-17(2)13-21(25(20)31-22)19(15-24(3)29-10-11-30-24)16-28-23(26)18-8-6-5-7-9-18/h5-9,17,19-22H,4,10-16H2,1-3H3/t17-,19-,20-,21-,22+/m1/s1 |
| InChIKey | XMJDNWOLODNYHS-FYKMYLNBSA-N |
| XLogP | 3.78 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |