C21H32NO5+ — CID 147033211
[3-(benzoyloxymethyl)-7,7-diethyl-9,9-dimethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl]oxidanium (PubChem CID 147033211) has the molecular formula C21H32NO5+ and a molecular weight of 378.49 g/mol. Its IUPAC name is [3-(benzoyloxymethyl)-7,7-diethyl-9,9-dimethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl]oxidanium.
| Compound Name | [3-(benzoyloxymethyl)-7,7-diethyl-9,9-dimethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl]oxidanium |
|---|---|
| PubChem CID | 147033211 |
| Molecular Formula | C21H32NO5+ |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | [3-(benzoyloxymethyl)-7,7-diethyl-9,9-dimethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl]oxidanium |
| SMILES | CCC1(CC)CC2(CC(C)(C)N1[OH2+])OCC(COC(=O)c1ccccc1)O2 |
| InChI | InChI=1S/C21H31NO5/c1-5-20(6-2)15-21(14-19(3,4)22(20)24)26-13-17(27-21)12-25-18(23)16-10-8-7-9-11-16/h7-11,17,24H,5-6,12-15H2,1-4H3/p+1 |
| InChIKey | AXZQHYXJKGHQFN-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 70.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|