C16H23NO3 — CID 21421452
(2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-yl) benzoate (PubChem CID 21421452) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-yl) benzoate.
| Compound Name | (2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-yl) benzoate |
|---|---|
| PubChem CID | 21421452 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-yl) benzoate |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2)CC(C)(C)[NH+]1[O-] |
| InChI | InChI=1S/C16H23NO3/c1-15(2)10-13(11-16(3,4)17(15)19)20-14(18)12-8-6-5-7-9-12/h5-9,13,17H,10-11H2,1-4H3 |
| InChIKey | CSOAKOXNCONARL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 53.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |