C22H24ClN3O — CID 10809899
3-(1-benzylpiperidin-4-yl)-5-(2-chlorophenyl)-4-methyl-1H-imidazol-2-one (PubChem CID 10809899) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-4-yl)-5-(2-chlorophenyl)-4-methyl-1H-imidazol-2-one.
| Compound Name | 3-(1-benzylpiperidin-4-yl)-5-(2-chlorophenyl)-4-methyl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 10809899 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 3-(1-benzylpiperidin-4-yl)-5-(2-chlorophenyl)-4-methyl-1H-imidazol-2-one |
| SMILES | Cc1c(-c2ccccc2Cl)[nH]c(=O)n1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H24ClN3O/c1-16-21(19-9-5-6-10-20(19)23)24-22(27)26(16)18-11-13-25(14-12-18)15-17-7-3-2-4-8-17/h2-10,18H,11-15H2,1H3,(H,24,27) |
| InChIKey | BQYLCESBRUFPJL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |