C22H21Cl2N5 — CID 10812330
N'-(7-chloroquinolin-4-yl)-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]ethane-1,2-diamine (PubChem CID 10812330) has the molecular formula C22H21Cl2N5 and a molecular weight of 426.35 g/mol. Its IUPAC name is N'-(7-chloroquinolin-4-yl)-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-(7-chloroquinolin-4-yl)-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 10812330 |
| Molecular Formula | C22H21Cl2N5 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N'-(7-chloroquinolin-4-yl)-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]ethane-1,2-diamine |
| SMILES | Clc1ccc2c(NCCNCCNc3ccnc4cc(Cl)ccc34)ccnc2c1 |
| InChI | InChI=1S/C22H21Cl2N5/c23-15-1-3-17-19(5-7-26-21(17)13-15)28-11-9-25-10-12-29-20-6-8-27-22-14-16(24)2-4-18(20)22/h1-8,13-14,25H,9-12H2,(H,26,28)(H,27,29) |
| InChIKey | HRUWSRXSOBVXEI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|