C25H34N4O3 — CID 10812937
4-acetamido-N-[2-[benzyl(methyl)amino]-2-oxoethyl]-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 10812937) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 4-acetamido-N-[2-[benzyl(methyl)amino]-2-oxoethyl]-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 4-acetamido-N-[2-[benzyl(methyl)amino]-2-oxoethyl]-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 10812937 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 4-acetamido-N-[2-[benzyl(methyl)amino]-2-oxoethyl]-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCN(CC)CCN(CC(=O)N(C)Cc1ccccc1)C(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C25H34N4O3/c1-5-28(6-2)16-17-29(19-24(31)27(4)18-21-10-8-7-9-11-21)25(32)22-12-14-23(15-13-22)26-20(3)30/h7-15H,5-6,16-19H2,1-4H3,(H,26,30) |
| InChIKey | VTVRNNVKHQAZBK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |