C27H19ClFN3 — CID 10812985
N-(4-chlorophenyl)-1-(4-fluorophenyl)-3,4-diphenylpyrazol-5-amine (PubChem CID 10812985) has the molecular formula C27H19ClFN3 and a molecular weight of 439.92 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-(4-fluorophenyl)-3,4-diphenylpyrazol-5-amine.
| Compound Name | N-(4-chlorophenyl)-1-(4-fluorophenyl)-3,4-diphenylpyrazol-5-amine |
|---|---|
| PubChem CID | 10812985 |
| Molecular Formula | C27H19ClFN3 |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-(4-chlorophenyl)-1-(4-fluorophenyl)-3,4-diphenylpyrazol-5-amine |
| SMILES | Fc1ccc(-n2nc(-c3ccccc3)c(-c3ccccc3)c2Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H19ClFN3/c28-21-11-15-23(16-12-21)30-27-25(19-7-3-1-4-8-19)26(20-9-5-2-6-10-20)31-32(27)24-17-13-22(29)14-18-24/h1-18,30H |
| InChIKey | VICLAXIKTVGYHD-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |