C27H28ClN5 — CID 2420381
3-[(4-benzylpiperazin-1-yl)methyl]-1-(4-chlorophenyl)-4-phenylpyrazol-5-amine (PubChem CID 2420381) has the molecular formula C27H28ClN5 and a molecular weight of 458.01 g/mol. Its IUPAC name is 3-[(4-benzylpiperazin-1-yl)methyl]-1-(4-chlorophenyl)-4-phenylpyrazol-5-amine.
| Compound Name | 3-[(4-benzylpiperazin-1-yl)methyl]-1-(4-chlorophenyl)-4-phenylpyrazol-5-amine |
|---|---|
| PubChem CID | 2420381 |
| Molecular Formula | C27H28ClN5 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 3-[(4-benzylpiperazin-1-yl)methyl]-1-(4-chlorophenyl)-4-phenylpyrazol-5-amine |
| SMILES | Nc1c(-c2ccccc2)c(CN2CCN(Cc3ccccc3)CC2)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H28ClN5/c28-23-11-13-24(14-12-23)33-27(29)26(22-9-5-2-6-10-22)25(30-33)20-32-17-15-31(16-18-32)19-21-7-3-1-4-8-21/h1-14H,15-20,29H2 |
| InChIKey | ZLXOOKWHVYPQQO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |