C7H10ClN3 — CID 10813
2-chloro-N,N,6-trimethylpyrimidin-4-amine (PubChem CID 10813) has the molecular formula C7H10ClN3 and a molecular weight of 171.63 g/mol. Its IUPAC name is 2-chloro-N,N,6-trimethylpyrimidin-4-amine.
| Compound Name | 2-chloro-N,N,6-trimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 10813 |
| Molecular Formula | C7H10ClN3 |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 2-chloro-N,N,6-trimethylpyrimidin-4-amine |
| SMILES | Cc1cc(N(C)C)nc(Cl)n1 |
| InChI | InChI=1S/C7H10ClN3/c1-5-4-6(11(2)3)10-7(8)9-5/h4H,1-3H3 |
| InChIKey | HJIUPFPIEBPYIE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |