C28H29NO4 — CID 10813139
benzyl (2S,3S,4S)-2-ethenyl-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate (PubChem CID 10813139) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is benzyl (2S,3S,4S)-2-ethenyl-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3S,4S)-2-ethenyl-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10813139 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | benzyl (2S,3S,4S)-2-ethenyl-3,4-bis(phenylmethoxy)pyrrolidine-1-carboxylate |
| SMILES | C=C[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H29NO4/c1-2-25-27(32-20-23-14-8-4-9-15-23)26(31-19-22-12-6-3-7-13-22)18-29(25)28(30)33-21-24-16-10-5-11-17-24/h2-17,25-27H,1,18-21H2/t25-,26-,27-/m0/s1 |
| InChIKey | QQFOFZARJHVSPW-QKDODKLFSA-N |
| XLogP | 5.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|