C18H16N4O3 — CID 1081327
1,3-dimethyl-7-(naphthalen-1-ylmethyl)-9H-purine-2,6,8-trione (PubChem CID 1081327) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 1,3-dimethyl-7-(naphthalen-1-ylmethyl)-9H-purine-2,6,8-trione.
| Compound Name | 1,3-dimethyl-7-(naphthalen-1-ylmethyl)-9H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 1081327 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1,3-dimethyl-7-(naphthalen-1-ylmethyl)-9H-purine-2,6,8-trione |
| SMILES | Cn1c(=O)c2c([nH]c(=O)n2Cc2cccc3ccccc23)n(C)c1=O |
| InChI | InChI=1S/C18H16N4O3/c1-20-15-14(16(23)21(2)18(20)25)22(17(24)19-15)10-12-8-5-7-11-6-3-4-9-13(11)12/h3-9H,10H2,1-2H3,(H,19,24) |
| InChIKey | RFTOOSODWHZEIA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |