C18H22N4O5 — CID 1263492
7-[(3,4-diethoxyphenyl)methyl]-1,3-dimethyl-9H-purine-2,6,8-trione (PubChem CID 1263492) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is 7-[(3,4-diethoxyphenyl)methyl]-1,3-dimethyl-9H-purine-2,6,8-trione.
| Compound Name | 7-[(3,4-diethoxyphenyl)methyl]-1,3-dimethyl-9H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 1263492 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 7-[(3,4-diethoxyphenyl)methyl]-1,3-dimethyl-9H-purine-2,6,8-trione |
| SMILES | CCOc1ccc(Cn2c(=O)[nH]c3c2c(=O)n(C)c(=O)n3C)cc1OCC |
| InChI | InChI=1S/C18H22N4O5/c1-5-26-12-8-7-11(9-13(12)27-6-2)10-22-14-15(19-17(22)24)20(3)18(25)21(4)16(14)23/h7-9H,5-6,10H2,1-4H3,(H,19,24) |
| InChIKey | GGPVOCTYYNEMSM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |