C22H28F3NO4Si — CID 10813640
N-[(4,5-dimethoxy-2-trimethylsilylphenyl)methyl]-2,2,2-trifluoro-N-[2-(4-hydroxyphenyl)ethyl]acetamide (PubChem CID 10813640) has the molecular formula C22H28F3NO4Si and a molecular weight of 455.55 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-trimethylsilylphenyl)methyl]-2,2,2-trifluoro-N-[2-(4-hydroxyphenyl)ethyl]acetamide.
| Compound Name | N-[(4,5-dimethoxy-2-trimethylsilylphenyl)methyl]-2,2,2-trifluoro-N-[2-(4-hydroxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 10813640 |
| Molecular Formula | C22H28F3NO4Si |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-[(4,5-dimethoxy-2-trimethylsilylphenyl)methyl]-2,2,2-trifluoro-N-[2-(4-hydroxyphenyl)ethyl]acetamide |
| SMILES | COc1cc(CN(CCc2ccc(O)cc2)C(=O)C(F)(F)F)c([Si](C)(C)C)cc1OC |
| InChI | InChI=1S/C22H28F3NO4Si/c1-29-18-12-16(20(31(3,4)5)13-19(18)30-2)14-26(21(28)22(23,24)25)11-10-15-6-8-17(27)9-7-15/h6-9,12-13,27H,10-11,14H2,1-5H3 |
| InChIKey | NGVWOSPIMOPEMT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|