C31H36O3 — CID 10813699
(3Z)-3-[[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methylidene]-5-methyl-1-benzofuran-2-one (PubChem CID 10813699) has the molecular formula C31H36O3 and a molecular weight of 456.63 g/mol. Its IUPAC name is (3Z)-3-[[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methylidene]-5-methyl-1-benzofuran-2-one.
| Compound Name | (3Z)-3-[[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methylidene]-5-methyl-1-benzofuran-2-one |
|---|---|
| PubChem CID | 10813699 |
| Molecular Formula | C31H36O3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | (3Z)-3-[[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methylidene]-5-methyl-1-benzofuran-2-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C=C(/C=C5\C(=O)Oc6ccc(C)cc65)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H36O3/c1-18-5-10-28-23(15-18)24(29(33)34-28)17-20-11-13-30(3)21(16-20)6-7-22-26-9-8-25(19(2)32)31(26,4)14-12-27(22)30/h5-6,10,15-17,22,25-27H,7-9,11-14H2,1-4H3/b24-17-/t22-,25+,26-,27-,30-,31+/m0/s1 |
| InChIKey | BXVPIGGASXIXCF-ZFPUEJKYSA-N |
| XLogP | 7.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|