C27H37NO2 — CID 11090831
1-[(E)-2-[(8S,9S,10R,13S,14S)-17-acetyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]ethenyl]pyrrolidin-2-one (PubChem CID 11090831) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 1-[(E)-2-[(8S,9S,10R,13S,14S)-17-acetyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]ethenyl]pyrrolidin-2-one.
| Compound Name | 1-[(E)-2-[(8S,9S,10R,13S,14S)-17-acetyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]ethenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11090831 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 1-[(E)-2-[(8S,9S,10R,13S,14S)-17-acetyl-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]ethenyl]pyrrolidin-2-one |
| SMILES | CC(=O)C1CC[C@H]2[C@@H]3CC=C4C=C(/C=C/N5CCCC5=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H37NO2/c1-18(29)22-8-9-23-21-7-6-20-17-19(12-16-28-15-4-5-25(28)30)10-13-26(20,2)24(21)11-14-27(22,23)3/h6,12,16-17,21-24H,4-5,7-11,13-15H2,1-3H3/b16-12+/t21-,22?,23-,24-,26-,27+/m0/s1 |
| InChIKey | KRGLKNJXIQXMPM-YEVLKWKESA-N |
| XLogP | 5.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |