About (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one
(3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one (PubChem CID 10814842) has the molecular formula C20H16Br2N4O
and a molecular weight of 488.18 g/mol. Its IUPAC name is (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one.
Molecular Properties
| Compound Name | (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one |
| PubChem CID | 10814842 |
| Molecular Formula | C20H16Br2N4O |
| Molecular Weight | 488.18 g/mol |
| Exact Mass | 485.97 |
| IUPAC Name | (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one |
| SMILES | O=C1N[C@H](c2c[nH]c3cc(Br)ccc23)CN[C@H]1c1c[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C20H16Br2N4O/c21-10-1-3-12-14(7-23-16(12)5-10)18-9-25-19(20(27)26-18)15-8-24-17-6-11(22)2-4-13(15)17/h1-8,18-19,23-25H,9H2,(H,26,27)/t18-,19-/m0/s1 |
| InChIKey | WQWGKDGEXNWWHH-OALUTQOASA-N |
| XLogP | 4.68 |
| TPSA | 72.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.18 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one?
The IUPAC name of (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one (CID 10814842) is (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one.
What is the SMILES notation for (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one?
The canonical SMILES for (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one is O=C1N[C@H](c2c[nH]c3cc(Br)ccc23)CN[C@H]1c1c[nH]c2cc(Br)ccc12.
What is the InChIKey of (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one?
The InChIKey is WQWGKDGEXNWWHH-OALUTQOASA-N. The full InChI is InChI=1S/C20H16Br2N4O/c21-10-1-3-12-14(7-23-16(12)5-10)18-9-25-19(20(27)26-18)15-8-24-17-6-11(22)2-4-13(15)17/h1-8,18-19,23-25H,9H2,(H,26,27)/t18-,19-/m0/s1.
What are the key properties of (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one?
(3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one has a molecular weight of 488.18 g/mol, XLogP of 4.68, 2 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,6R)-3,6-bis(6-bromo-1H-indol-3-yl)piperazin-2-one is sourced from PubChem (CID 10814842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).