C29H48O6 — CID 10815026
(2R,4R,5S,15R,16S)-15-[(2S,3R,4R,5S)-5-cyclobutyl-3,4-dihydroxyhexan-2-yl]-4,5-dihydroxy-2,16-dimethyl-8-oxatetracyclo[9.7.0.02,7.012,16]octadecan-9-one (PubChem CID 10815026) has the molecular formula C29H48O6 and a molecular weight of 492.70 g/mol. Its IUPAC name is (2R,4R,5S,15R,16S)-15-[(2S,3R,4R,5S)-5-cyclobutyl-3,4-dihydroxyhexan-2-yl]-4,5-dihydroxy-2,16-dimethyl-8-oxatetracyclo[9.7.0.02,7.012,16]octadecan-9-one.
| Compound Name | (2R,4R,5S,15R,16S)-15-[(2S,3R,4R,5S)-5-cyclobutyl-3,4-dihydroxyhexan-2-yl]-4,5-dihydroxy-2,16-dimethyl-8-oxatetracyclo[9.7.0.02,7.012,16]octadecan-9-one |
|---|---|
| PubChem CID | 10815026 |
| Molecular Formula | C29H48O6 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | (2R,4R,5S,15R,16S)-15-[(2S,3R,4R,5S)-5-cyclobutyl-3,4-dihydroxyhexan-2-yl]-4,5-dihydroxy-2,16-dimethyl-8-oxatetracyclo[9.7.0.02,7.012,16]octadecan-9-one |
| SMILES | C[C@H]([C@@H](O)[C@H](O)[C@@H](C)C1CCC1)[C@H]1CCC2C3CC(=O)OC4C[C@H](O)[C@H](O)C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H48O6/c1-15(17-6-5-7-17)26(33)27(34)16(2)19-8-9-20-18-12-25(32)35-24-13-22(30)23(31)14-29(24,4)21(18)10-11-28(19,20)3/h15-24,26-27,30-31,33-34H,5-14H2,1-4H3/t15-,16-,18?,19+,20?,21?,22-,23+,24?,26+,27+,28+,29+/m0/s1 |
| InChIKey | IILXNTCFZBYNRK-HMKTZZFASA-N |
| XLogP | 3.68 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |