C27H46O7 — CID 135016205
(2R,4R,5S,15R,16S)-4,5-dihydroxy-2,16-dimethyl-15-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-methylheptan-2-yl]-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one (PubChem CID 135016205) has the molecular formula C27H46O7 and a molecular weight of 482.66 g/mol. Its IUPAC name is (2R,4R,5S,15R,16S)-4,5-dihydroxy-2,16-dimethyl-15-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-methylheptan-2-yl]-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one.
| Compound Name | (2R,4R,5S,15R,16S)-4,5-dihydroxy-2,16-dimethyl-15-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-methylheptan-2-yl]-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one |
|---|---|
| PubChem CID | 135016205 |
| Molecular Formula | C27H46O7 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | (2R,4R,5S,15R,16S)-4,5-dihydroxy-2,16-dimethyl-15-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-methylheptan-2-yl]-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one |
| SMILES | CC(C)[C@H](O)[C@@H](O)[C@H](O)[C@@H](C)[C@H]1CCC2C3COC(=O)C4C[C@H](O)[C@H](O)C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H46O7/c1-13(2)22(30)24(32)23(31)14(3)16-6-7-17-15-12-34-25(33)19-10-20(28)21(29)11-27(19,5)18(15)8-9-26(16,17)4/h13-24,28-32H,6-12H2,1-5H3/t14-,15?,16+,17?,18?,19?,20-,21+,22-,23+,24+,26+,27+/m0/s1 |
| InChIKey | DSNLXQPDAOBAEE-LMALHPDTSA-N |
| XLogP | 2.11 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |