C29H42O6 — CID 132516443
(1S,2R,4R,5S,11S,12S,15R,16S)-15-[(2S,3R,4R)-3,4-dihydroxy-4-phenylbutan-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one (PubChem CID 132516443) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is (1S,2R,4R,5S,11S,12S,15R,16S)-15-[(2S,3R,4R)-3,4-dihydroxy-4-phenylbutan-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one.
| Compound Name | (1S,2R,4R,5S,11S,12S,15R,16S)-15-[(2S,3R,4R)-3,4-dihydroxy-4-phenylbutan-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one |
|---|---|
| PubChem CID | 132516443 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | (1S,2R,4R,5S,11S,12S,15R,16S)-15-[(2S,3R,4R)-3,4-dihydroxy-4-phenylbutan-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one |
| SMILES | C[C@H]([C@@H](O)[C@H](O)c1ccccc1)[C@H]1CC[C@H]2[C@@H]3COC(=O)C4C[C@H](O)[C@H](O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H42O6/c1-16(25(32)26(33)17-7-5-4-6-8-17)19-9-10-20-18-15-35-27(34)22-13-23(30)24(31)14-29(22,3)21(18)11-12-28(19,20)2/h4-8,16,18-26,30-33H,9-15H2,1-3H3/t16-,18-,19+,20-,21-,22?,23-,24+,25+,26+,28+,29+/m0/s1 |
| InChIKey | RJMUSUVJXDQGBB-HJMYKDHOSA-N |
| XLogP | 3.47 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |