C29H48O6 — CID 91366175
(2R,4R,5S,15R,16S)-15-[(2S,3R,4R)-3,4-dihydroxy-5-propan-2-ylhept-5-en-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one (PubChem CID 91366175) has the molecular formula C29H48O6 and a molecular weight of 492.70 g/mol. Its IUPAC name is (2R,4R,5S,15R,16S)-15-[(2S,3R,4R)-3,4-dihydroxy-5-propan-2-ylhept-5-en-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one.
| Compound Name | (2R,4R,5S,15R,16S)-15-[(2S,3R,4R)-3,4-dihydroxy-5-propan-2-ylhept-5-en-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one |
|---|---|
| PubChem CID | 91366175 |
| Molecular Formula | C29H48O6 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | (2R,4R,5S,15R,16S)-15-[(2S,3R,4R)-3,4-dihydroxy-5-propan-2-ylhept-5-en-2-yl]-4,5-dihydroxy-2,16-dimethyl-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one |
| SMILES | CC=C(C(C)C)[C@@H](O)[C@H](O)[C@@H](C)[C@H]1CCC2C3COC(=O)C4C[C@H](O)[C@H](O)C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H48O6/c1-7-17(15(2)3)26(33)25(32)16(4)19-8-9-20-18-14-35-27(34)22-12-23(30)24(31)13-29(22,6)21(18)10-11-28(19,20)5/h7,15-16,18-26,30-33H,8-14H2,1-6H3/t16-,18?,19+,20?,21?,22?,23-,24+,25+,26+,28+,29+/m0/s1 |
| InChIKey | LRRBQWHWKJDDAW-CMIVEILDSA-N |
| XLogP | 3.70 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|