About CID 10815533
CID 10815533 (PubChem CID 10815533) has the molecular formula C26H30NO2
and a molecular weight of 388.53 g/mol.
Molecular Properties
| Compound Name | CID 10815533 |
| PubChem CID | 10815533 |
| Molecular Formula | C26H30NO2 |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | — |
| SMILES | CCCCCC#C[C@@H](c1ccco1)N(C[C]1[CH][CH][CH][CH]1)[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C26H30NO2/c1-2-3-4-5-9-17-24(26-18-12-19-29-26)27(20-22-13-10-11-14-22)25(21-28)23-15-7-6-8-16-23/h6-8,10-16,18-19,24-25,28H,2-5,20-21H2,1H3/t24-,25-/m0/s1 |
| InChIKey | HDEJCOSXJOSSJU-DQEYMECFSA-N |
| XLogP | 5.35 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 10815533 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10815533?
The IUPAC name of CID 10815533 (CID 10815533) is not available.
What is the SMILES notation for CID 10815533?
The canonical SMILES for CID 10815533 is CCCCCC#C[C@@H](c1ccco1)N(C[C]1[CH][CH][CH][CH]1)[C@@H](CO)c1ccccc1.
What is the InChIKey of CID 10815533?
The InChIKey is HDEJCOSXJOSSJU-DQEYMECFSA-N. The full InChI is InChI=1S/C26H30NO2/c1-2-3-4-5-9-17-24(26-18-12-19-29-26)27(20-22-13-10-11-14-22)25(21-28)23-15-7-6-8-16-23/h6-8,10-16,18-19,24-25,28H,2-5,20-21H2,1H3/t24-,25-/m0/s1.
What are the key properties of CID 10815533?
CID 10815533 has a molecular weight of 388.53 g/mol, XLogP of 5.35, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10815533 is sourced from PubChem (CID 10815533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).