C33H38O7S — CID 10817032
3-[(2S,3S,4S,5R,6R)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]sulfanylpentane-2,4-dione (PubChem CID 10817032) has the molecular formula C33H38O7S and a molecular weight of 578.73 g/mol. Its IUPAC name is 3-[(2S,3S,4S,5R,6R)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]sulfanylpentane-2,4-dione.
| Compound Name | 3-[(2S,3S,4S,5R,6R)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]sulfanylpentane-2,4-dione |
|---|---|
| PubChem CID | 10817032 |
| Molecular Formula | C33H38O7S |
| Molecular Weight | 578.73 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 3-[(2S,3S,4S,5R,6R)-2-methoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]sulfanylpentane-2,4-dione |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1SC(C(C)=O)C(C)=O |
| InChI | InChI=1S/C33H38O7S/c1-23(34)31(24(2)35)41-32-30(39-21-27-17-11-6-12-18-27)29(38-20-26-15-9-5-10-16-26)28(40-33(32)36-3)22-37-19-25-13-7-4-8-14-25/h4-18,28-33H,19-22H2,1-3H3/t28-,29-,30+,32+,33+/m1/s1 |
| InChIKey | NCDCAUGWFBDSAI-ZTWUEOBVSA-N |
| XLogP | 5.39 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.73 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|