C29H39F3N4O6 — CID 10817314
[amino-[4-[[1-[4-(carboxymethyl)piperidin-1-yl]-2,2-dimethyl-1-oxoheptan-3-yl]-prop-2-ynylcarbamoyl]phenyl]methylidene]azanium;2,2,2-trifluoroacetate (PubChem CID 10817314) has the molecular formula C29H39F3N4O6 and a molecular weight of 596.65 g/mol. Its IUPAC name is [amino-[4-[[1-[4-(carboxymethyl)piperidin-1-yl]-2,2-dimethyl-1-oxoheptan-3-yl]-prop-2-ynylcarbamoyl]phenyl]methylidene]azanium;2,2,2-trifluoroacetate.
| Compound Name | [amino-[4-[[1-[4-(carboxymethyl)piperidin-1-yl]-2,2-dimethyl-1-oxoheptan-3-yl]-prop-2-ynylcarbamoyl]phenyl]methylidene]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10817314 |
| Molecular Formula | C29H39F3N4O6 |
| Molecular Weight | 596.65 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | [amino-[4-[[1-[4-(carboxymethyl)piperidin-1-yl]-2,2-dimethyl-1-oxoheptan-3-yl]-prop-2-ynylcarbamoyl]phenyl]methylidene]azanium;2,2,2-trifluoroacetate |
| SMILES | C#CCN(C(=O)c1ccc(C(N)=[NH2+])cc1)C(CCCC)C(C)(C)C(=O)N1CCC(CC(=O)O)CC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C27H38N4O4.C2HF3O2/c1-5-7-8-22(27(3,4)26(35)30-16-13-19(14-17-30)18-23(32)33)31(15-6-2)25(34)21-11-9-20(10-12-21)24(28)29;3-2(4,5)1(6)7/h2,9-12,19,22H,5,7-8,13-18H2,1,3-4H3,(H3,28,29)(H,32,33);(H,6,7) |
| InChIKey | XYLXHDPGCFINBP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 169.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.65 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|