C27H40FN4O5+ — CID 10794092
2-[1-[3-[[4-[amino-(4-hydroxypiperidin-1-ium-1-ylidene)methyl]-2-fluorobenzoyl]amino]-2,2-dimethylpentanoyl]piperidin-4-yl]acetic acid (PubChem CID 10794092) has the molecular formula C27H40FN4O5+ and a molecular weight of 519.64 g/mol. Its IUPAC name is 2-[1-[3-[[4-[amino-(4-hydroxypiperidin-1-ium-1-ylidene)methyl]-2-fluorobenzoyl]amino]-2,2-dimethylpentanoyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[3-[[4-[amino-(4-hydroxypiperidin-1-ium-1-ylidene)methyl]-2-fluorobenzoyl]amino]-2,2-dimethylpentanoyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 10794092 |
| Molecular Formula | C27H40FN4O5+ |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | 2-[1-[3-[[4-[amino-(4-hydroxypiperidin-1-ium-1-ylidene)methyl]-2-fluorobenzoyl]amino]-2,2-dimethylpentanoyl]piperidin-4-yl]acetic acid |
| SMILES | CCC(NC(=O)c1ccc(C(N)=[N+]2CCC(O)CC2)cc1F)C(C)(C)C(=O)N1CCC(CC(=O)O)CC1 |
| InChI | InChI=1S/C27H39FN4O5/c1-4-22(27(2,3)26(37)32-11-7-17(8-12-32)15-23(34)35)30-25(36)20-6-5-18(16-21(20)28)24(29)31-13-9-19(33)10-14-31/h5-6,16-17,19,22,29,33H,4,7-15H2,1-3H3,(H2,30,34,35,36)/p+1 |
| InChIKey | QPEPKJAVKGKEOX-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 135.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|