C8H15NO2 — CID 10820830
(2R,8S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-2,8-diol (PubChem CID 10820830) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (2R,8S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-2,8-diol.
| Compound Name | (2R,8S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-2,8-diol |
|---|---|
| PubChem CID | 10820830 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (2R,8S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-2,8-diol |
| SMILES | O[C@@H]1C[C@@H]2[C@@H](O)CCCN2C1 |
| InChI | InChI=1S/C8H15NO2/c10-6-4-7-8(11)2-1-3-9(7)5-6/h6-8,10-11H,1-5H2/t6-,7-,8+/m1/s1 |
| InChIKey | HIIULVRVDILYIC-PRJMDXOYSA-N |
| XLogP | -0.42 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |