C10H16F2O — CID 10821509
trans-(2S,6S)-4-tert-butyl-2,6-difluorocyclohexan-1-one (PubChem CID 10821509) has the molecular formula C10H16F2O and a molecular weight of 190.23 g/mol. Its IUPAC name is trans-(2S,6S)-4-tert-butyl-2,6-difluorocyclohexan-1-one.
| Compound Name | trans-(2S,6S)-4-tert-butyl-2,6-difluorocyclohexan-1-one |
|---|---|
| PubChem CID | 10821509 |
| Molecular Formula | C10H16F2O |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | trans-(2S,6S)-4-tert-butyl-2,6-difluorocyclohexan-1-one |
| SMILES | CC(C)(C)C1C[C@H](F)C(=O)[C@@H](F)C1 |
| InChI | InChI=1S/C10H16F2O/c1-10(2,3)6-4-7(11)9(13)8(12)5-6/h6-8H,4-5H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | RBJQPMRPCDOAHM-YUMQZZPRSA-N |
| XLogP | 2.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |