About 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione
5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione (PubChem CID 10822679) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione |
| PubChem CID | 10822679 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione |
| SMILES | CCC1C=CCC2=C1C(=O)C=C(OC)C2=O |
| InChI | InChI=1S/C13H14O3/c1-3-8-5-4-6-9-12(8)10(14)7-11(16-2)13(9)15/h4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | UOZALKCPJXASSZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione?
The IUPAC name of 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione (CID 10822679) is 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione.
What is the SMILES notation for 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione?
The canonical SMILES for 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione is CCC1C=CCC2=C1C(=O)C=C(OC)C2=O.
What is the InChIKey of 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione?
The InChIKey is UOZALKCPJXASSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3/c1-3-8-5-4-6-9-12(8)10(14)7-11(16-2)13(9)15/h4-5,7-8H,3,6H2,1-2H3.
What are the key properties of 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione?
5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione has a molecular weight of 218.25 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-methoxy-5,8-dihydronaphthalene-1,4-dione is sourced from PubChem (CID 10822679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).