C12H13NO2S — CID 10823655
N-[3-(benzenesulfinyl)buta-1,3-dien-2-yl]acetamide (PubChem CID 10823655) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is N-[3-(benzenesulfinyl)buta-1,3-dien-2-yl]acetamide.
| Compound Name | N-[3-(benzenesulfinyl)buta-1,3-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 10823655 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | N-[3-(benzenesulfinyl)buta-1,3-dien-2-yl]acetamide |
| SMILES | C=C(NC(C)=O)C(=C)S(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13NO2S/c1-9(13-11(3)14)10(2)16(15)12-7-5-4-6-8-12/h4-8H,1-2H2,3H3,(H,13,14) |
| InChIKey | GBUBUFASMNWBQU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|