About [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride
[N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride (PubChem CID 10824415) has the molecular formula C8H11Cl2N5
and a molecular weight of 248.12 g/mol. Its IUPAC name is [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride.
Molecular Properties
| Compound Name | [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride |
| PubChem CID | 10824415 |
| Molecular Formula | C8H11Cl2N5 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride |
| SMILES | NC(N)=[NH+]/C(N)=N/c1ccc(Cl)cc1.[Cl-] |
| InChI | InChI=1S/C8H10ClN5.ClH/c9-5-1-3-6(4-2-5)13-8(12)14-7(10)11;/h1-4H,(H6,10,11,12,13,14);1H |
| InChIKey | NAFSLMFLGYXGIF-UHFFFAOYSA-N |
| XLogP | -4.36 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride?
The IUPAC name of [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride (CID 10824415) is [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride.
What is the SMILES notation for [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride?
The canonical SMILES for [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride is NC(N)=[NH+]/C(N)=N/c1ccc(Cl)cc1.[Cl-].
What is the InChIKey of [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride?
The InChIKey is NAFSLMFLGYXGIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN5.ClH/c9-5-1-3-6(4-2-5)13-8(12)14-7(10)11;/h1-4H,(H6,10,11,12,13,14);1H.
What are the key properties of [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride?
[N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride has a molecular weight of 248.12 g/mol, XLogP of -4.36, 1 rotatable bonds, 4 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [N'-(4-chlorophenyl)carbamimidoyl]-(diaminomethylidene)azanium chloride is sourced from PubChem (CID 10824415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).