C14H21NO3 — CID 10824644
1-(3,3-dimethyl-1-nitrobutan-2-yl)oxyethylbenzene (PubChem CID 10824644) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(3,3-dimethyl-1-nitrobutan-2-yl)oxyethylbenzene.
| Compound Name | 1-(3,3-dimethyl-1-nitrobutan-2-yl)oxyethylbenzene |
|---|---|
| PubChem CID | 10824644 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-(3,3-dimethyl-1-nitrobutan-2-yl)oxyethylbenzene |
| SMILES | CC(OC(C[N+](=O)[O-])C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H21NO3/c1-11(12-8-6-5-7-9-12)18-13(10-15(16)17)14(2,3)4/h5-9,11,13H,10H2,1-4H3 |
| InChIKey | GYMHTANZQOJMFD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|