C10H10FNO3 — CID 71723426
(2R,3S)-2-ethyl-3-(4-fluorophenyl)-2-nitrooxirane (PubChem CID 71723426) has the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. Its IUPAC name is (2R,3S)-2-ethyl-3-(4-fluorophenyl)-2-nitrooxirane.
| Compound Name | (2R,3S)-2-ethyl-3-(4-fluorophenyl)-2-nitrooxirane |
|---|---|
| PubChem CID | 71723426 |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | (2R,3S)-2-ethyl-3-(4-fluorophenyl)-2-nitrooxirane |
| SMILES | CC[C@@]1([N+](=O)[O-])O[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C10H10FNO3/c1-2-10(12(13)14)9(15-10)7-3-5-8(11)6-4-7/h3-6,9H,2H2,1H3/t9-,10+/m0/s1 |
| InChIKey | UXKZOICNUSNLME-VHSXEESVSA-N |
| XLogP | 2.28 |
| TPSA | 55.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|