C13H11FN2O4 — CID 10826429
1-[(4-fluorophenyl)methyl]-5-methyl-4-nitropyrrole-2-carboxylic acid (PubChem CID 10826429) has the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-5-methyl-4-nitropyrrole-2-carboxylic acid.
| Compound Name | 1-[(4-fluorophenyl)methyl]-5-methyl-4-nitropyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 10826429 |
| Molecular Formula | C13H11FN2O4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-5-methyl-4-nitropyrrole-2-carboxylic acid |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)O)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H11FN2O4/c1-8-11(16(19)20)6-12(13(17)18)15(8)7-9-2-4-10(14)5-3-9/h2-6H,7H2,1H3,(H,17,18) |
| InChIKey | JTGCMYATWJUIPN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|