C15H11FN2O6 — CID 18363519
4-[1-[(4-fluorophenyl)methyl]-4-nitropyrrol-2-yl]-2,4-dioxobutanoic acid (PubChem CID 18363519) has the molecular formula C15H11FN2O6 and a molecular weight of 334.26 g/mol. Its IUPAC name is 4-[1-[(4-fluorophenyl)methyl]-4-nitropyrrol-2-yl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[1-[(4-fluorophenyl)methyl]-4-nitropyrrol-2-yl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 18363519 |
| Molecular Formula | C15H11FN2O6 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 4-[1-[(4-fluorophenyl)methyl]-4-nitropyrrol-2-yl]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cc([N+](=O)[O-])cn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H11FN2O6/c16-10-3-1-9(2-4-10)7-17-8-11(18(23)24)5-12(17)13(19)6-14(20)15(21)22/h1-5,8H,6-7H2,(H,21,22) |
| InChIKey | HWPMKGPOYGVKAT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|