C16H17FN2O4S — CID 20696859
N-[1-[(4-fluorophenyl)methyl]-5-(3-oxobutanoyl)pyrrol-3-yl]methanesulfonamide (PubChem CID 20696859) has the molecular formula C16H17FN2O4S and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]-5-(3-oxobutanoyl)pyrrol-3-yl]methanesulfonamide.
| Compound Name | N-[1-[(4-fluorophenyl)methyl]-5-(3-oxobutanoyl)pyrrol-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 20696859 |
| Molecular Formula | C16H17FN2O4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]-5-(3-oxobutanoyl)pyrrol-3-yl]methanesulfonamide |
| SMILES | CC(=O)CC(=O)c1cc(NS(C)(=O)=O)cn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN2O4S/c1-11(20)7-16(21)15-8-14(18-24(2,22)23)10-19(15)9-12-3-5-13(17)6-4-12/h3-6,8,10,18H,7,9H2,1-2H3 |
| InChIKey | UVDRGKFHYCPOCD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|