C15H11FINO4 — CID 510815
4-[1-[(4-fluorophenyl)methyl]-4-iodopyrrol-2-yl]-2,4-dioxobutanoic acid (PubChem CID 510815) has the molecular formula C15H11FINO4 and a molecular weight of 415.16 g/mol. Its IUPAC name is 4-[1-[(4-fluorophenyl)methyl]-4-iodopyrrol-2-yl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[1-[(4-fluorophenyl)methyl]-4-iodopyrrol-2-yl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 510815 |
| Molecular Formula | C15H11FINO4 |
| Molecular Weight | 415.16 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 4-[1-[(4-fluorophenyl)methyl]-4-iodopyrrol-2-yl]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cc(I)cn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H11FINO4/c16-10-3-1-9(2-4-10)7-18-8-11(17)5-12(18)13(19)6-14(20)15(21)22/h1-5,8H,6-7H2,(H,21,22) |
| InChIKey | VDJSPLGSMYAWAM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|